Stable isotope labeling allows researchers to study metabolic pathways in vivo in a safe manner.
Stable isotope-labeled compounds are used as environmental pollutant standards for the detection of air, water, soil, sediment and food.
In addition to treating various diseases, isotopes are used for imaging, diagnosis, and newborn screening.
Small molecule compounds labeled with stable isotopes can be used as chemical reference for chemical identification, qualitative, quantitative, detection, etc. Various types of NMR solvents can be used to study the structure, reaction mechanism and reaction kinetics of compounds.
Stable isotope labeling allows researchers to study metabolic pathways in vivo in a safe manner.
Stable isotope-labeled compounds are used as environmental pollutant standards for the detection of air, water, soil, sediment and food.
General Information |
---|
Catalog: BLP-010406 |
CAS: 1560-62-9 |
Molecular Formula: C4H2D6 |
Molecular Weight: 62.14 |
Chemical Structure |
---|
![]() |
Synonyms | 2-Methyl-D3-propene-3,3,3-D3; 1-Propene-3,3,3-D3, 2-(Methyl-D3)-; 2-Methylpropene-D6; 1,1-Dimethylethene-D6; 1,1-Dimethylethylene-D6; 2-Methyl-1-propene-D6; 2-Methyl-2-propene-D6; Isobutene-D6; Isobutylene-D6; Isopropylidenemethylene-D6; i-Butene-D6; γ-Butylene-D6 |
IUPAC Name | 3,3,3-trideuterio-2-(trideuteriomethyl)prop-1-ene |
Related CAS | 115-11-7 (unlabelled) |
Canonical SMILES | CC(=C)C |
InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3/i2D3,3D3 |
InChI Key | VQTUBCCKSQIDNK-XERRXZQWSA-N |
Purity | 98%; 98% atom D |
Solubility | Soluble in Water |
Appearance | Colorless Gas |
Storage | Store at 2-8°C |
2-Methylpropene-[d6], a deuterium-labeled compound, is widely used in various scientific and industrial applications. Here are some key applications of 2-Methylpropene-[d6]:
NMR Spectroscopy: In nuclear magnetic resonance (NMR) spectroscopy, 2-Methylpropene-[d6] serves as a valuable reference and solvent due to its deuterated nature. It provides clear and distinct signals that enhance the resolution of NMR spectra. This allows chemists to accurately study molecular structures and dynamics without interference from solvent signals.
Isotope Labeling Studies: 2-Methylpropene-[d6] is utilized in isotope labeling experiments to trace chemical pathways and reaction mechanisms. By incorporating this deuterium-labeled compound into chemical reactions, researchers can monitor the movement of specific atoms. This provides insights into reaction intermediates and helps in elucidating complex chemical transformations.
Polymer Science: In polymer chemistry, 2-Methylpropene-[d6] is used to study polymerization processes and the properties of resulting polymers. The deuterium labeling allows for the detailed analysis of polymer structure and behavior under different conditions. This contributes to the development of advanced polymer materials with desired characteristics, such as enhanced strength or flexibility.
Chemical Kinetics: Researchers employ 2-Methylpropene-[d6] in studies of chemical kinetics and reaction rates. The presence of deuterium affects the vibrational modes and bond strengths, providing unique insights into reaction dynamics. This information is crucial for optimizing reaction conditions in industrial processes and understanding fundamental aspects of chemical reactivity.
Interested in our Service & Products?
Need detailed information?