| Description |
Labelled Methoxy Psoralen. Methoxsalen, also called xanthotoxin, marketed under the trade names Oxsoralen, Deltasoralen, Meladinine, is a drug used to treat psoriasis, eczema, vitiligo, and some cutaneous lymphomas in conjunction with exposing the skin to UVA light from lamps or sunlight. |
| Synonyms |
9-(Methoxy-13CD3)-7H-furo[3,2-g][1]benzopyran-7-one; 6-Hydroxy-7-(methoxy-13CD3)-5-benzofuranacrylic Acid δ-Lactone; 8-MOP-13CD3; 8-MP-13CD3; 8-(Methoxy-13CD3)-6,7-furanocoumarin; 8-(Methoxy-13CD3)[furano-3',2':6,7-coumarin]; 8-(Methoxy-13CD3)psoralene; Ammodin-13CD3; Ammoidin-13CD3; Deltapsoralen-13CD3; Geroxalen-13CD3; Meladinin-13CD3; Meladinine-13CD3; Meladoxen-13CD3; Meloxine-13CD3; Methoxsalen-13CD3; Methoxsalene-13CD3; NSC 45923-13CD3; New-Meladinin-13CD3; Oxsoralen-13CD3; Oxypsoralen-13CD3; Puvalen-13CD3; Puvamet-13CD3; Uvadex-13CD3; Vitpso-13CD3; Xanthotoxin-13CD3; Xanthotoxine-13CD3 |
| IUPAC Name |
9-(trideuterio(1-13C)methoxy)furo[3,2-g]chromen-7-one |
| Related CAS |
298-81-7 (unlabelled)
|
| Canonical SMILES |
COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
| InChI |
InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3/i1+1D3 |
| InChI Key |
QXKHYNVANLEOEG-KQORAOOSSA-N |
| Melting Point |
138-141°C |
| Purity |
> 98% |
| Solubility |
Soluble in Chloroform (Slightly, Sonicated), DMSO (Slightly) |
| Appearance |
Pale Yellow Solid |
| Storage |
-20°C |
![8-Methoxy Psoralen-[13C,d3]](/isotope.v1/images/structure-default.jpg)
