| Description |
A labelled form of Amlodipine Maleate. Amlodipine maleate is a long-acting dihydropyridine calcium antagonist (calcium ion antagonist or slow-channel blocker). It inhibits the movement of calcium ions into vascular smooth muscle cells and cardiac muscle cells. It is a peripheral arterial vasodilator that acts directly on vascular smooth muscle to cause a reduction in peripheral vascular resistance and reduction in blood pressure. It binds to both dihydropyridine and nondihydropyridine binding sites. It inhibits calcium ion influx across cell membranes selectively, with a greater effect on vascular smooth muscle cells than on cardiac muscle cells. It has a prolonged half-life due to its high efficiency. |
| Synonyms |
2-[(2-Aminoethoxy)methyl]-4-(2-chlorophenyl)-3-ethoxycarbonyl-5-methoxycarbonyl)-6-methyl-1,4-dihydropyridine-d4 Maleic Acid Salt; Amlodipine D4 Maleic Acid; 2-[(2-Aminoethoxy)methyl]-4-methyl-1,4-dihydropyridine-d4 Malec cid Salt |
| IUPAC Name |
(Z)-but-2-enedioic acid;3-O-ethyl 5-O-methyl 2-[(2-amino-1,1,2,2-tetradeuterioethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Related CAS |
88150-47-4 (unlabelled)
|
| Canonical SMILES |
CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.C(=CC(=O)O)C(=O)O |
| InChI |
InChI=1S/C20H25ClN2O5.C4H4O4/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;5-3(6)1-2-4(7)8/h5-8,17,23H,4,9-11,22H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/i9D2,10D2; |
| InChI Key |
TZNOWAJJWCGILX-IBTKSTAFSA-N |
| Melting Point |
163-174°C |
| Purity |
97% |
| Solubility |
Soluble in Methanol (Slightly) |
| Appearance |
White to Pale Yellow Solid |
| Storage |
-20°C |
![Amlodipine-[d4] Maleic Acid Salt](https://resource.bocsci.com/structure/1185246-15-4.gif)
