| Description |
L-Valine-d8-N-t-BOC is a labelled L-Valine-N-t-BOC. Valine is a branched-chain amino acid used in the protein biosynthesis. It is essential for animals with insulin-resistant property. |
| Synonyms |
N-(tert-Butoxycarbonyl)-L-valine-d8,L-Valine-d8; N-t-Boc derivative; Boc-Val-OH-d8; L-Valine-d8-N-t-BOC |
| IUPAC Name |
(2S)-2,3,4,4,4-pentadeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trideuteriomethyl)butanoic acid |
| Canonical SMILES |
CC(C)C(C(=O)O)NC(=O)OC(C)(C)C |
| InChI |
InChI=1S/C10H19NO4/c1-6(2)7(8(12)13)11-9(14)15-10(3,4)5/h6-7H,1-5H3,(H,11,14)(H,12,13)/t7-/m0/s1/i1D3,2D3,6D,7D |
| InChI Key |
SZXBQTSZISFIAO-SSOOLOFBSA-N |
| Melting Point |
77-80 °C (lit.) |
| Purity |
98% atom D |
| Appearance |
Solid |
