| Description |
Chlorpromazine-[d6] hydrochloride is the labelled salt of Chlorpromazine. Chlorpromazine is an antipsychotic medication. It is primarily used to treat psychotic disorders such as schizophrenia. |
| Synonyms |
Chlorpromazine-D6 hydrochloride; Thorazine-d6 hydrochloride; Largactil-d6 hydrochloride; Contomin-d6 hydrochloride; Chlorderazin-d6 hydrochloride; Aminazine-d6 hydrochloride; 2-Chloro-N,N-(dimethyl-d6)-10H-phenothiazine-10-propanamine Hydrochloride; 2-Chloro-10-[3-(dimethylamino-d6)propyl]phenothiazine Hydrochloride; Klorproman-d6; Marazine-d6; Norcozine-d6; Torazina-d6; Tranzene-d6 |
| IUPAC Name |
3-(2-chlorophenothiazin-10-yl)-N,N-bis(trideuteriomethyl)propan-1-amine;hydrochloride |
| Related CAS |
69-09-0 (unlabelled) 50-53-3 (unlabelled free base) 1224691-01-3 (free base)
|
| Isomeric SMILES |
[2H]C([2H])([2H])N(CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl)C([2H])([2H])[2H].Cl |
| Canonical SMILES |
CN(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl.Cl |
| InChI |
InChI=1S/C17H19ClN2S.ClH/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20;/h3-4,6-9,12H,5,10-11H2,1-2H3;1H/i1D3,2D3; |
| InChI Key |
FBSMERQALIEGJT-TXHXQZCNSA-N |
| Melting Point |
184-189°C |
| Purity |
≥95%; ≥99% atom D |
| Solubility |
Soluble in Chloroform (Slightly), Methanol (Slightly), Water (Very Slightly) |
| Appearance |
Off-White to Pale Yellow Solid |
| Application |
Labelled Chlorpromazine. Used as an antiemetic and antipsychotic. |
| Shelf Life |
As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
| Storage |
Store at -20°C |
![Chlorpromazine-[d6] hydrochloride](https://resource.bocsci.com/structure/1228182-46-4.gif)
