| Description |
Cholesterol-[d4] is the labelled analogue of Cholesterol, which is an animal sterol found in human bodies and Olea europaea L. It is a precursor of other steroid compounds. |
| Synonyms |
Cholesterol D4; Cholesterol-25,26,26,26-d4; (3β)-Cholest-5-en-3-ol-d4; (-)-Cholesterol-d4; 3β-Hydroxycholest-5-ene-d4; Cholest-5-en-3β-ol-d4; Cholesterin-d4; Cholesteryl-d4 alcohol; Dythol-d4; Lidinite-d4; NSC 8798-d4; Provitamin D-d4; 5-Cholesten-3β-ol-d4; (3beta)-(25,26,26,26-d4)Cholest-5-en-3-ol |
| IUPAC Name |
(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6,7,7,7-tetradeuterio-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Related CAS |
57-88-5 (unlabelled)
|
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C |
| Canonical SMILES |
CC(C)CCCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C |
| InChI |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1/i1D3,18D/t18?,19-,21+,22+,23-,24+,25+,26+,27- |
| InChI Key |
HVYWMOMLDIMFJA-CRNPSRDESA-N |
| Melting Point |
143-146°C |
| Purity |
≥96%; ≥98% atom D |
| Solubility |
Slightly soluble in Chloroform, Methanol (Heated) |
| Appearance |
White to Off-white Solid |
| Storage |
Store at 2-8°C under inert atmosphere |
![Cholesterol-[d4]](https://resource.bocsci.com/structure/956029-28-0.gif)
