| Description |
Colterol-[d9], is the labelled analogue of Colterol. Colterol is a short-acting β2-adrenoreceptor agonist. |
| Synonyms |
Colterol D9; 4-(1-Hydroxy-2-{[2-(2H3)methyl(2H6)propan-2-yl]amino}ethyl)benzene-1,2-diol |
| IUPAC Name |
4-[2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,2-diol |
| Canonical SMILES |
CC(C)(C)NCC(C1=CC(=C(C=C1)O)O)O |
| InChI |
InChI=1S/C12H19NO3/c1-12(2,3)13-7-11(16)8-4-5-9(14)10(15)6-8/h4-6,11,13-16H,7H2,1-3H3/i1D3,2D3,3D3 |
| InChI Key |
PHSMOUBHYUFTDM-GQALSZNTSA-N |
| Melting Point |
>91°C (dec.) |
| Purity |
95% (CP); 98% atom D |
| Solubility |
Soluble in DMSO, Methanol |
| Appearance |
White to Very Dark Brown Solid |
| Storage |
Store at -20°C, under inert atmosphere |
