| Description |
Fmoc-Phe-OH-[d8] is the labelled analogue of L-Phenylalanine-N-FMOC. Phenylalanine is an α-amino acid essential for humans that is found in breast milk of mammals. It is commonly used as a dietary supplement. |
| Synonyms |
N-(9-Fluorenylmethoxycarbonyl)-L-phenyl-d5-alanine-d3; L-Phenyl-d5-alanine-d3 N-Fmoc derivative; Fmoc-Phe-OH-(phenyl-d5)-2,3,3-d3; N-9-Fluorenylmethoxycarbonyl-L-phenylalanine-d8; N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine-d8; NSC 334293-d8; N-FMOC-L-phenylalanine-d8; FMOC-L-Phenylalanine-d8; FMOC-L-Phe-OH-d8 |
| IUPAC Name |
(2S)-2,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Canonical SMILES |
C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
| InChI |
InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1/i1D,2D,3D,8D,9D,14D2,22D |
| InChI Key |
SJVFAHZPLIXNDH-PLPXMBJESA-N |
| Melting Point |
180-187 °C |
| Purity |
98% atom D |
| Solubility |
Soluble in Chloroform |
| Appearance |
White Solid |
| Storage |
−20 °C under inert atmosphere |
