| Description |
Guanosine 3',5'-cyclic monophosphate-[13C10,15N5] calcium salt is the labelled analogue of Guanosine 3',5'-cyclic monophosphate calcium salt. Guanosine 3',5'-cyclic monophosphate calcium salt is a calcium salt form of Cyclic guanosine monophosphate. Cyclic guanosine monophosphate (Cyclic GMP) is a guanine nucleotide containing one phosphate group which is esterified to the sugar moiety in both the 3'-and 5'-positions. It is a cellular regulatory agent and has been described as a second messenger. It has a role as a plant metabolite, a human metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a mouse metabolite. |
| Synonyms |
GMP-13C10,15N5; Guanosine-13C10,15N5 3',5'-cyclic monophosphate calcium salt |
| IUPAC Name |
calcium (4aR,6R,7R)-6-(2-(amino-15N)-6-oxo-1,6-dihydro-9H-purin-9-yl-13C5-15N4)-7-hydroxytetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-olate-4,4a,6,7,7a-13C5 2-oxide |
| Related CAS |
7665-99-8 (unlabelled free base)
|
| Canonical SMILES |
C1C2C(C(C(O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)[O-].C1C2C(C(C(O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)[O-].[Ca+2] |
| InChI |
InChI=1S/2C10H12N5O7P.Ca/c2*11-10-13-7-4(8(17)14-10)12-2-15(7)9-5(16)6-3(21-9)1-20-23(18,19)22-6;/h2*2-3,5-6,9,16H,1H2,(H,18,19)(H3,11,13,14,17);/q;;+2/p-2/t2*3-,5-,6-,9-;/m11./s1/i2*1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1; |
| InChI Key |
UWPRAAHTBFUSLT-NDZKCIGYSA-L |
| Purity |
95% (CP); 99% atom 13C; 98% atom 15N |
![Guanosine 3',5'-cyclic monophosphate-[13C10,15N5] calcium salt](/isotope.v1/images/structure-default.jpg)
