| Description |
Metronidazole-[d4] Hydrochloride is the labelled salt of Metronidazole, which is a synthetic antibacterial and antiprotozoal agent of the nitroimidazole class. It is a limited spectrum antibiotic that has activity against anaerobic gram-positive and anaerobic gram-negative bacteria. |
| Synonyms |
2-Methyl-5-nitro-1H-imidazole-1-(ethanol-d4) hydrochloride; Anagiardil-d4 hydrochloride; Arilin-d4 hydrochloride; Bayer 5360-d4 hydrochloride; Cimetrol 500LPCI-d4 hydrochloride; Clont-d4 hydrochloride; Deflamon-d4 hydrochloride; Dentamet Gel-d4 hydrochloride; Efloran-d4 hydrochloride; Elyzol-d4 hydrochloride; Entizol-d4 hydrochloride; Flagesol-d4 hydrochloride; Flagil-d4 hydrochloride; 1-(2-Hydroxyethyl-d4)-2-methyl-5-nitroimidazole hydrochloride; NSC 50364-d4 hydrochloride; NSC 69587-d4 hydrochloride; Nidazole-d4 hydrochloride |
| IUPAC Name |
1,1,2,2-tetradeuterio-2-(2-methyl-5-nitroimidazol-1-yl)ethanol;hydrochloride |
| Related CAS |
69198-10-3 (unlabelled) 443-48-1 (unlabelled free base) 1261392-47-5 (free base)
|
| Isomeric SMILES |
[2H]C([2H])(C([2H])([2H])O)N1C(=NC=C1[N+](=O)[O-])C.Cl |
| Canonical SMILES |
CC1=NC=C(N1CCO)[N+](=O)[O-].Cl |
| InChI |
InChI=1S/C6H9N3O3.ClH/c1-5-7-4-6(9(11)12)8(5)2-3-10;/h4,10H,2-3H2,1H3;1H/i2D2,3D2; |
| InChI Key |
FPTPAIQTXYFGJC-DAHDXRBSSA-N |
| Purity |
99.8% HPLC; 99% atom D |
| Solubility |
Soluble in DMSO (Slightly), Methanol (Slightly) |
| Appearance |
Off-white Solid |
| Storage |
Store at 2-8°C |
![Metronidazole-[d4] Hydrochloride](https://resource.bocsci.com/structure/1261397-74-3.gif)
