| Description |
Propafenone Dimer Impurity-[d10], is an isotope labelled derivative of Propafenone Dimer Impurity, which is an impurity of Propafenone. Propafenone is an anti-arrhythmic medication. It can be used for the treatment of illnesses associated with rapid heart beats such as atrial and ventricular arrhythmias. |
| Synonyms |
Propafenone Dimer Impurity D10; 1,1'-[Propyliminobis[[2-hydroxy(propane-d5)-1,3-diyl]oxy-2,1-phenylene]]bis(3-phenylpropan-1-one) |
| IUPAC Name |
1-[2-[1,1,2,3,3-pentadeuterio-2-hydroxy-3-[[1,1,2,3,3-pentadeuterio-2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]propyl]-propylamino]propoxy]phenyl]-3-phenylpropan-1-one |
| Related CAS |
1346603-80-2 (unlabelled)
|
| Isomeric SMILES |
[2H]C([2H])(C([2H])(C([2H])([2H])OC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O)N(CCC)C([2H])([2H])C([2H])(C([2H])([2H])OC3=CC=CC=C3C(=O)CCC4=CC=CC=C4)O |
| Canonical SMILES |
CCCN(CC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O)CC(COC3=CC=CC=C3C(=O)CCC4=CC=CC=C4)O |
| InChI |
InChI=1S/C39H45NO6/c1-2-25-40(26-32(41)28-45-38-19-11-9-17-34(38)36(43)23-21-30-13-5-3-6-14-30)27-33(42)29-46-39-20-12-10-18-35(39)37(44)24-22-31-15-7-4-8-16-31/h3-20,32-33,41-42H,2,21-29H2,1H3/i26D2,27D2,28D2,29D2,32D,33D |
| InChI Key |
LSQHIGTXXXXQHQ-QKCORRFFSA-N |
| Boiling Point |
784.4±60.0°C at 760 mmHg |
| Purity |
>98% |
| Density |
1.2±0.1 g/cm3 |
| Solubility |
Soluble in Chloroform, Ethyl Acetate |
| Appearance |
Pale Yellow Thick Oil |
| Storage |
Store at-20°C |
![Propafenone Dimer Impurity-[d10]](/isotope.v1/images/structure-default.jpg)
