| Description |
Prostaglandin F2α-[d9], one of the most biologically studied primary prostaglandins. Prostaglandin F2α is closely related to Prostaglandin E2 (PGE2) in which both prostaglandins are biosynthesized from the same precursors. |
| Synonyms |
(5Z,9α,11α,13E,15S)-9,11,15-Trihydroxy-prosta-5,13-dien-1-oic Acid-d9; 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic Acid-d9; (+)-Prostaglandin F2α-d9; 7-[3,5-Dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl]-5-heptenoic Acid-d9; 9α,11α,15(S)-Trihydroxy-5-cis-13-trans-prostadienoic Acid-d9; 9α,11α-PGF2-d9; 9α,11α-PGF2α-d9; Amoglandin-d9; Croniben-d9; Cyclosin-d9; Dinifertin-d9; Dinoprost-d9; Enzaprost-d9; Enzaprost F-d9; PGF2a-d9; PGF2α-d9; Panacelan-d9; Prostaglandin F2-d9; Prostaglandin F2a-d9; Prostamate-d9; Prostarmon F-d9; Prostin F 2 Alpha-d9; Protamodin-d9; U 14583-d9 |
| IUPAC Name |
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-5,5,6,6,7,7,8,8,8-nonadeuterio-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| Related CAS |
551-11-1 (unlabelled)
|
| Canonical SMILES |
CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O |
| InChI |
InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-,19+/m0/s1/i1D3,2D2,3D2,6D2 |
| InChI Key |
PXGPLTODNUVGFL-CYICHRNFSA-N |
| Boiling Point |
531.0 ± 50.0 °C at 760 mmHg |
| Purity |
≥99% deuterated forms (d1-d9) |
| Density |
1.2±0.1 g/cm3 |
| Solubility |
Soluble in DMF ,DMSO ,Ethanol |
| Appearance |
A solution in methyl acetate |
| Storage |
-20°C |
![Prostaglandin F2α-[d9]](https://resource.bocsci.com/structure/prostaglandin%20f2%CE%B1-%5Bd9%5D.gif)
