| Description |
Squalene-[d6] is the labelled form of Squalene, a natural triterpene that plays an important role in the synthesis of cholesterol, steroid hormones, and vitamin D in the human body. Squalene is commonly used as a biochemical precursor in the preparation of steroids. Squalene is also a natural moisturizer with low acute toxicity and is not significant human skin irritants or sensitizers. |
| Synonyms |
(6E,10E,14E,18E)-2,6,10,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexaene-d6; 2,6,10,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexaene-d6; Nikko Squalane EX-d6; Spinacene-d6; Squalen-d6; all-trans-Squalene-d6; trans-Squalene-d6; (all-E)-2,6,10,15,19,23-Hexamethyl-2,6,10,14,18,22-tetracosahexaene-d6; (E,E,E,E)-Squalene-d6 |
| IUPAC Name |
(6E,10E,14E,18E)-1,1,1-trideuterio-6,10,15,19,23-pentamethyl-2-(trideuteriomethyl)tetracosa-2,6,10,14,18,22-hexaene |
| Related CAS |
111-02-4 (unlabelled)
|
| Canonical SMILES |
CC(=CCCC(=CCCC(=CCCC=C(C)CCC=C(C)CCC=C(C)C)C)C)C |
| InChI |
InChI=1S/C30H50/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h15-18,23-24H,9-14,19-22H2,1-8H3/b27-17+,28-18+,29-23+,30-24+/i1D3,2D3 |
| InChI Key |
YYGNTYWPHWGJRM-FSAUMQCISA-N |
| Purity |
95.16%; 97.4% atom D |
| Solubility |
Chloroform (Slightly) ,Hexane (Slightly) |
| Appearance |
Colorless Oil |
| Storage |
-20°C ,Inert atmosphere ,Light sensitive |
![Squalene-[d6]](https://resource.bocsci.com/structure/squalene-%5Bd6%5D.gif)
