| Description |
Topotecan-[d5] is the labelled analogue of Topotecan. Topocecan is a semisynthetic derivative of camptothecin with antineoplastic activity. During the S phase of the cell cycle, topotecan selectively stabilizes topoisomerase I-DNA covalent complexes, inhibiting religation of topoisomerase I-mediated single-strand DNA breaks and producing potentially lethal double-strand DNA breaks when complexes are encountered by the DNA replication machinery. Camptothecin is a cytotoxic quinoline-based alkaloid extracted from the Asian tree Camptotheca acuminata. |
| Synonyms |
Topotecan D5 |
| IUPAC Name |
(19S)-8-[(dimethylamino)methyl]-7,19-dihydroxy-19-(1,1,2,2,2-pentadeuterioethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| Related CAS |
119413-54-6 (unlabelled)
|
| Isomeric SMILES |
[2H]C([2H])([2H])C([2H])([2H])[C@@]1(C2=C(COC1=O)C(=O)N3CC4=CC5=C(C=CC(=C5CN(C)C)O)N=C4C3=C2)O |
| Canonical SMILES |
CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=C(C=CC(=C5CN(C)C)O)N=C4C3=C2)O |
| InChI |
InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1/i1D3,4D2 |
| InChI Key |
UCFGDBYHRUNTLO-NTSVIFQKSA-N |
| Boiling Point |
782.9±60.0 °C at 760 mmHg |
| Melting Point |
>200°C (dec.) |
| Purity |
95% atom D |
| Density |
1.5±0.1 g/cm3 |
| Solubility |
Soluble in DMSO, Methanol |
| Appearance |
Yellow Solid |
| Application |
Labelled Topotecan (T542500). A DNA topoisomerase I inhibitor; semisynthetic analog of Camptothecin. Antineoplastic. |
| Storage |
Store at -20°C |
![Topotecan-[d5]](https://resource.bocsci.com/structure/1133355-98-2.gif)
