| Description |
Labelled Voreloxin Hydrochloride. Vosaroxin intercalates into DNA in a site-specific manner and blocks the religation process carried out by topoisomerase II during DNA replication. As a result, inhibition of DNA replication, RNA and protein synthesis occurs, followed by cell cycle arrest at G2 phase and induced p53-independent apoptosis. This agent shows a favorable toxicity profile in several aspects: it does not generate reactive oxygen species, as do anthracyclines, reducing the risk of cardiotoxicity; it is not a P-glycoprotein (P-gp) substrate, and thereby evades the common mechanism for multidrug resistance; and it has limited distribution to normal tissues and a more chemically stable molecular structure. |
| Synonyms |
7-[(3S,4S)-3-methoxy-4-[(13C,D3)methylamino]pyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid hydrochloride |
| IUPAC Name |
7-[(3S,4S)-3-(methylamino)-4-(trideuterio(1-13C)methoxy)pyrrolidin-1-yl]-4-oxo-1-(1,3-thiazol-2-yl)-1,8-naphthyridine-3-carboxylic acid;hydrochloride |
| Related CAS |
175519-16-1 (unlabelled)
|
| Canonical SMILES |
CNC1CN(CC1OC)C2=NC3=C(C=C2)C(=O)C(=CN3C4=NC=CS4)C(=O)O.Cl |
| InChI |
InChI=1S/C18H19N5O4S.ClH/c1-19-12-8-22(9-13(12)27-2)14-4-3-10-15(24)11(17(25)26)7-23(16(10)21-14)18-20-5-6-28-18;/h3-7,12-13,19H,8-9H2,1-2H3,(H,25,26);1H/t12-,13-;/m0./s1/i2+1D3; |
| InChI Key |
JJZCCQHWCOXGCL-POYQMJENSA-N |
| Purity |
>98% |
![Voreloxin-[13C,d3] Hydrochloride](/isotope.v1/images/structure-default.jpg)
