| Description |
Labelled 9-Amino-1,2,3,4-tetrahydroacridin-1-ol. A potential Alzheimer's Disease therapeutic of low toxicity. Exhibits biochemical and pharmacological profile similar to THA except that it is far less toxic and without measurable liver toxicity in humans. |
| Synonyms |
9-Amino-1,2,3,4-tetrahydro-1-acridinol-d3; HP 029-d3; Mentane-d3; P 83-6029A-d3; Velnacrine-d3; 1-Hydroxy Tacrine-d3 |
| IUPAC Name |
9-amino-1,2,2-trideuterio-3,4-dihydroacridin-1-ol |
| Canonical SMILES |
C1CC(C2=C(C3=CC=CC=C3N=C2C1)N)O |
| InChI |
InChI=1S/C13H14N2O/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13/h1-2,4-5,11,16H,3,6-7H2,(H2,14,15)/i7D2,11D |
| InChI Key |
HLVVITIHAZBPKB-XGWWUZNLSA-N |
| Melting Point |
>190°C (dec.) |
| Solubility |
Soluble in DMSO, Methanol |
| Appearance |
Beige Solid |
| Storage |
-20°C |
